CAS 66148-25-2

Hiyodorilactone B

Description:

Hiyodorilactone B, with the CAS number 66148-25-2, is a naturally occurring compound classified as a lactone. It is derived from certain species of fungi and is known for its unique structural features, which include a cyclic ester formation. This compound typically exhibits a range of biological activities, including potential antimicrobial and antifungal properties, making it of interest in pharmaceutical research. Hiyodorilactone B may also possess antioxidant characteristics, contributing to its potential applications in health and nutrition. The compound's solubility and stability can vary depending on environmental conditions, such as pH and temperature. Its molecular structure includes specific functional groups that influence its reactivity and interactions with other substances. As with many natural products, the study of Hiyodorilactone B can provide insights into its biosynthetic pathways and potential uses in drug development or as a lead compound for further synthetic modifications. Overall, Hiyodorilactone B represents a fascinating area of study within the field of organic chemistry and natural product research.

Formula: C₂₂H₂₈O₇

InChI: InChI=1/C22H28O7/c1-12-6-7-17(27-16(5)24)14(3)11-19-20(15(4)22(26)29-19)18(10-12)28-21(25)13(2)8-9-23/h6,8,11,17-20,23H,4,7,9-10H2,1-3,5H3/b12-6+,13-8+,14-11-/t17-,18+,19+,20+/m0/s1

InChI key: InChIKey=FOCCASNSHDSZLN-CGZYOCHMSA-N

SMILES: O(C(/C(=C/CO)/C)=O)[C@H]1[C@@]2([C@@](/C=C(/C)\[C@@H](OC(C)=O)C/C=C(\C)/C1)(OC(=O)C2=C)[H])[H]

Synonyms:

• Hiyodorilactone B
• 2-Butenoic acid, 4-hydroxy-2-methyl-, 9-(acetyloxy)-2,3,3a,4,5,8,9,11a-octahydro-6,10-dimethyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester, [3aR-[3aR*,4R*(E),6E,9S*,10Z,11aR*]]-
• Chromolaenide
• 2-Butenoic acid, 4-hydroxy-2-methyl-, (3aR,4R,6E,9S,10Z,11aR)-9-(acetyloxy)-2,3,3a,4,5,8,9,11a-octahydro-6,10-dimethyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester, (2E)-

Chromolaenide

CAS: 66148-25-2

Chromolaenide is a natural product from Chromolaena glaberrima.

Formula: C₂₂H₂₈O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 404.45

Ref: TM-TN3647

Chromolaenide

CAS: 66148-25-2

Formula: C₂₂H₂₈O₇

Purity: 95%~99%

Molecular weight: 404.459

Ref: BP-SBP04273

3-Epichromolaenide

CAS: 66148-25-2

3-Epichromolaenide is a naturally occurring sesquiterpene lactone, which is derived from various plant species, particularly within the Asteraceae family. It functions through the modulation of inflammatory pathways, primarily by inhibiting specific cytokines and enzymes involved in inflammatory responses. This mode of action positions it as a compound of interest in the study of anti-inflammatory agents.

Formula: C₂₂H₂₈O₇

Purity: Min. 95%

Molecular weight: 404.5 g/mol

Ref: 3D-RCA14825