CAS 661489-23-2
:(2E)-3-(4-Amino-3,5-dimethylphenyl)acrylonitrile hydrochloride (1:1)
Description:
(2E)-3-(4-Amino-3,5-dimethylphenyl)acrylonitrile hydrochloride is a chemical compound characterized by its structural features, which include an acrylonitrile moiety and an amino-substituted aromatic ring. The presence of the amino group indicates potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The compound is typically encountered as a hydrochloride salt, which enhances its solubility in polar solvents, facilitating its use in biological and chemical applications. The dimethyl substitutions on the phenyl ring contribute to its steric properties and may influence its biological activity. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, particularly in the development of therapeutic agents. As with many organic compounds, safety data should be consulted, as it may pose hazards such as toxicity or irritancy. Proper handling and storage conditions are essential to ensure safety and stability.
Formula:C11H13ClN2
InChI:InChI=1S/C11H12N2.ClH/c1-8-6-10(4-3-5-12)7-9(2)11(8)13;/h3-4,6-7H,13H2,1-2H3;1H/b4-3+;
Synonyms:- (E)-3-(4-Amino-3,5-dimethylphenyl)acrylonitrile Hydrochloride
- (E)-3-(4-Amino-3,5-dimethylphenyl)-2-propenenitrile hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(E)-3-(4-Amino-3,5-dimethylphenyl)acrylonitrile Hydrochloride
CAS:Formula:C11H12N2·HClPurity:>98.0%(N)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:208.69(E)-3-(4-Amino-3,5-dimethylphenyl)acrylonitrile hydrochloride
CAS:Formula:C11H13ClN2Purity:98%Color and Shape:SolidMolecular weight:208.6873(E)-3-(4-Amino-3,5-dimethylphenyl)acrylonitrile hydrochloride
CAS:(E)-3-(4-Amino-3,5-dimethylphenyl)acrylonitrile hydrochloridePurity:99%Molecular weight:208.69g/mol(E)-3-(4-Amino-3,5-dimethylphenyl)acrylonitrile hydrochloride
CAS:Formula:C11H13ClN2Purity:98%Color and Shape:SolidMolecular weight:208.69(E)-3-(4-Amino-3,5-dimethylphenyl)acrylonitrile Hydrochloride
CAS:Controlled Product<p>Applications Can be used in the preparation of 5,6-substituted pyrimidines that can possibly inhibit HIV strains resistant to reverse transcriptase inhibitors.<br></p>Formula:C11H12N2·ClHColor and Shape:NeatMolecular weight:208.69






