CAS 661489-24-3
:4-[[4-[(4-Iodo-2,6-dimethylphenyl)amino]-2-pyrimidinyl]amino]benzonitrile
Description:
4-[[4-[(4-Iodo-2,6-dimethylphenyl)amino]-2-pyrimidinyl]amino]benzonitrile, with the CAS number 661489-24-3, is a chemical compound characterized by its complex structure, which includes multiple aromatic rings and a pyrimidine moiety. This compound features a 4-iodo-2,6-dimethylphenyl group, indicating the presence of iodine and methyl substituents on the phenyl ring, which can influence its reactivity and solubility. The presence of the benzonitrile functional group suggests potential applications in pharmaceuticals, particularly in the development of targeted therapies due to its ability to interact with biological targets. The compound's molecular structure may confer specific properties such as lipophilicity, which can affect its bioavailability and pharmacokinetics. Additionally, the presence of nitrogen atoms in the pyrimidine and amino groups may contribute to hydrogen bonding capabilities, influencing its interactions in biological systems. Overall, this compound's unique characteristics make it of interest in medicinal chemistry and drug design.
Formula:C19H16IN5
InChI:InChI=1S/C19H16IN5/c1-12-9-15(20)10-13(2)18(12)24-17-7-8-22-19(25-17)23-16-5-3-14(11-21)4-6-16/h3-10H,1-2H3,(H2,22,23,24,25)
InChI key:InChIKey=HBAHWODMRDKKEE-UHFFFAOYSA-N
SMILES:N(C1=C(C)C=C(I)C=C1C)C2=NC(NC3=CC=C(C#N)C=C3)=NC=C2
Synonyms:- Benzonitrile, 4-[[4-[(4-iodo-2,6-dimethylphenyl)amino]-2-pyrimidinyl]amino]-
- 4-[[4-[(4-Iodo-2,6-dimethylphenyl)amino]-2-pyrimidinyl]amino]benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
