CAS 66154-69-6

2-(Methylsulfonyl)-4-pyridinecarbonitrile

Description:

2-(Methylsulfonyl)-4-pyridinecarbonitrile, with the CAS number 66154-69-6, is a chemical compound characterized by its pyridine ring structure substituted with a methylsulfonyl group and a cyano group. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals, particularly due to the presence of the cyano group, which can participate in various chemical reactions. The methylsulfonyl group enhances the compound's solubility and may influence its biological activity. Additionally, this compound may exhibit specific properties such as moderate to high stability under standard conditions, but it should be handled with care due to potential toxicity associated with its functional groups. As with many pyridine derivatives, it may also display interesting electronic properties, making it a subject of interest in material science and medicinal chemistry. Always consult safety data sheets and relevant literature for detailed handling and safety information.

Formula: C₇H₆N₂O₂S

InChI: InChI=1S/C7H6N2O2S/c1-12(10,11)7-4-6(5-8)2-3-9-7/h2-4H,1H3

InChI key: InChIKey=BQLGCIUPZRALSH-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C1=CC(C#N)=CC=N1

2-Methanesulfonylpyridine-4-carbonitrile

CAS: 66154-69-6

2-Methanesulfonylpyridine-4-carbonitrile

Purity: 96%

Molecular weight: 182.20g/mol

Ref: 54-OR911079

2-(Methylsulfonyl)isonicotinonitrile

CAS: 66154-69-6

Purity: 98%

Molecular weight: 182.1999969

Ref: 10-F604254

2-Methanesulfonylpyridine-4-carbonitrile

CAS: 66154-69-6

Versatile small molecule scaffold

Formula: C₇H₆N₂O₂S

Purity: Min. 95%

Molecular weight: 182.2 g/mol

Ref: 3D-RCA15469