CAS 66158-49-4

N-(4-chlorobenzyl)-2-cyanoacetamide

Description:

N-(4-chlorobenzyl)-2-cyanoacetamide is an organic compound characterized by its unique functional groups and structural features. It contains a cyano group (-C≡N) and an amide group (-C(=O)NH-) attached to a benzyl moiety that is substituted with a chlorine atom at the para position. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of biologically active compounds due to the presence of the cyano and amide functionalities, which can participate in various chemical reactions. The chlorobenzyl group may also enhance the compound's lipophilicity, influencing its biological activity and interaction with target proteins. As with many organic compounds, safety and handling precautions should be observed, as it may exhibit toxicity or irritant properties. Overall, N-(4-chlorobenzyl)-2-cyanoacetamide is of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₀H₉ClN₂O

InChI: InChI=1/C10H9ClN2O/c11-9-3-1-8(2-4-9)7-13-10(14)5-6-12/h1-4H,5,7H2,(H,13,14)

SMILES: c1cc(ccc1CN=C(CC#N)O)Cl

Synonyms:

• Acetamide, N-[(4-chlorophenyl)methyl]-2-cyano-
• N-(4-Chloro-benzyl)-2-cyano-acetamide
• N-(4-Chlorobenzyl)-2-cyanoacetamide

N-(4-Chlorobenzyl)-2-cyanoacetamide

CAS: 66158-49-4

Formula: C₁₀H₉ClN₂O

Molecular weight: 208.6443

Ref: IN-DA00FD4M

N-(4-Chlorobenzyl)-2-cyanoacetamide

CAS: 66158-49-4

N-(4-Chlorobenzyl)-2-cyanoacetamide

Purity: ≥95%

Molecular weight: 208.64g/mol

Ref: 54-OR14407