CAS 66158-96-1

2,3-Dihydro-1-benzofuran-2-ylmethanol

Description:

2,3-Dihydro-1-benzofuran-2-ylmethanol, with the CAS number 66158-96-1, is an organic compound characterized by its unique bicyclic structure that combines a benzofuran moiety with a hydroxymethyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, such as ethanol and dichloromethane, but has limited solubility in water due to its hydrophobic benzofuran ring. The presence of the hydroxymethyl group contributes to its reactivity, allowing it to participate in various chemical reactions, including oxidation and substitution. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules or as intermediates in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₉H₁₀O₂

InChI: InChI=1/C9H10O2/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-4,8,10H,5-6H2

SMILES: c1ccc2c(c1)CC(CO)O2

Synonyms:

• (2,3-Dihydrobenzofuran-2-Yl)Methanol

2,3-Dihydro-2-(hydroxymethyl)benzo[b]furan

CAS: 66158-96-1

2,3-Dihydro-2-(hydroxymethyl)benzo[b]furan

Purity: 97%

Color and Shape: Colourless Liquid

Molecular weight: 150.17g/mol

Ref: 54-OR1427

(2,3-Dihydro-benzofuran-2-yl)-methanol

CAS: 66158-96-1

Formula: C₉H₁₀O₂

Purity: 95.0%

Color and Shape: Liquid, Colourless liquid

Molecular weight: 150.177

Ref: 10-F057837