CAS 66163-76-6
:3-Hydroxyterphenyllin
Description:
3-Hydroxyterphenyllin, with the CAS number 66163-76-6, is an organic compound that belongs to the class of terphenyl derivatives. It is characterized by the presence of three phenyl rings connected by a central carbon chain, with a hydroxyl (-OH) group attached to one of the phenyl rings, which influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit a crystalline structure. It is known for its potential applications in various fields, including organic electronics, as a fluorescent material, and in the synthesis of other organic compounds. The hydroxyl group contributes to its solubility in polar solvents and can participate in hydrogen bonding, affecting its interactions with other molecules. Additionally, 3-Hydroxyterphenyllin may exhibit interesting optical properties, making it a subject of study in photochemistry and materials science. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as temperature and pH.
Formula:C20H18O6
InChI:InChI=1/C20H18O6/c1-25-17-10-14(11-3-6-13(21)7-4-11)20(26-2)19(24)18(17)12-5-8-15(22)16(23)9-12/h3-10,21-24H,1-2H3
InChI key:InChIKey=YLSPFNUVVOKJDF-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(O)=C(OC)C(=C1)C2=CC=C(O)C=C2)C3=CC(O)=C(O)C=C3
Synonyms:- NSC 299113
- [1,1′:4′,1′′-Terphenyl]-2′,3,4,4′′-tetrol, 3′,6′-dimethoxy-
- 3',6'-Dimethoxy-(1,1':4',1''-terphenyl)-2',3,4,4''-tetrol
- 3′,6′-Dimethoxy[1,1′:4′,1′′-terphenyl]-2′,3,4,4′′-tetrol
- 3-Hydroxyterphenyllin
- [1,1':4',1''-Terphenyl]-2',3,4,4''-tetrol, 3',6'-dimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Hydroxyterphenyllin
CAS:3-Hydroxyterphenyllin from A. candidus is a fungal compound with antioxidant, anticancer, antibacterial, and antiviral effects.Formula:C20H18O6Color and Shape:SolidMolecular weight:354.353-Hydroxyterphenyllin
CAS:Controlled Product<p>3-Hydroxyterphenyllin is a natural compound that has been shown to have anticancer activity. It can be used as an anticancer agent for the treatment of cancer tissues. 3-Hydroxyterphenyllin has antioxidative properties and can inhibit the growth of prostate cancer cells. It also has pro-apoptotic properties, which leads to cell death by apoptosis, or programmed cell death. The apoptotic effect of 3-hydroxyterphenyllin is due to its ability to activate pro-apoptotic proteins such as Bax and Bak, which are involved in the mitochondrial membrane potential and the release of cytochrome c from mitochondria. 3-Hydroxyterphenyllin also inhibits nuclear DNA synthesis by binding to nucleic acid bases, preventing their incorporation into DNA strands.</p>Formula:C20H18O6Purity:Min. 95%Molecular weight:354.4 g/mol

