CAS 66176-17-8

8-Methyl-2H-3,1-benzoxazine-2,4(1H)-dione

Description:

8-Methyl-2H-3,1-benzoxazine-2,4(1H)-dione, also known by its CAS number 66176-17-8, is a heterocyclic organic compound characterized by its benzoxazine structure, which features a fused benzene and oxazine ring. This compound typically exhibits a solid state at room temperature and is known for its potential applications in various fields, including materials science and pharmaceuticals. It possesses functional groups that contribute to its reactivity, particularly the dione moiety, which can participate in various chemical reactions such as nucleophilic additions and cycloadditions. The presence of the methyl group at the 8-position influences its electronic properties and steric hindrance, potentially affecting its reactivity and interactions with other molecules. Additionally, compounds of this class may exhibit interesting biological activities, making them subjects of research in medicinal chemistry. Overall, 8-Methyl-2H-3,1-benzoxazine-2,4(1H)-dione is a compound of interest due to its unique structural features and potential applications.

Formula: C₉H₇NO₃

InChI: InChI=1/C9H7NO3/c1-5-3-2-4-6-7(5)10-9(12)13-8(6)11/h2-4H,1H3,(H,10,12)

SMILES: Cc1cccc2c1nc(O)oc2=O

Synonyms:

• 2H-3,1-Benzoxazine-2,4(1H)-dione, 8-methyl-

2H-3,1-Benzoxazine-2,4(1H)-dione,8-methyl-

CAS: 66176-17-8

Formula: C₉H₇NO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 177.1568

Ref: IN-DA006Q0T

3-Methylisatoic anhydride

CAS: 66176-17-8

3-Methylisatoic anhydride

Formula: C₉H₇NO₃

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 177.16g/mol

Ref: 54-OR30520

3-Methyl-isatoic anhydride

CAS: 66176-17-8

Formula: C₉H₇NO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 177.159

Ref: 10-F011816

3-Methylisatoic anhydride

CAS: 66176-17-8

Versatile small molecule scaffold

Formula: C₉H₇NO₃

Purity: Min. 95%

Molecular weight: 177.16 g/mol

Ref: 3D-RCA17617