CAS 66178-41-4
:1,1,1-Trifluoromethanesulfonic acid-d
Description:
1,1,1-Trifluoromethanesulfonic acid-d, also known as triflic acid-d, is a deuterated form of triflic acid, which is a strong acid and a potent electrophile. It is characterized by the presence of three fluorine atoms attached to a carbon atom, along with a sulfonic acid functional group. The deuteration (indicated by the "d") refers to the substitution of hydrogen atoms with deuterium, a heavier isotope of hydrogen, which can be useful in various analytical applications, including NMR spectroscopy. This compound is highly soluble in polar solvents and exhibits strong acidity, making it a valuable reagent in organic synthesis and catalysis. Its stability under a range of conditions, along with its ability to protonate various substrates, enhances its utility in chemical reactions. However, due to its corrosive nature, it must be handled with care, using appropriate safety measures to avoid contact with skin or inhalation of vapors.
Formula:CDF3O3S
InChI:InChI=1S/CHF3O3S/c2-1(3,4)8(5,6)7/h(H,5,6,7)/i/hD
InChI key:InChIKey=ITMCEJHCFYSIIV-DYCDLGHISA-N
SMILES:C(S(=O)(=O)O[2H])(F)(F)F
Synonyms:- 1,1,1-Trifluoromethanesulfonic acid-d
- Deuteriotriflic acid
- Deuterotrifluoromethanesulfonic acid
- Methanesulfonic acid-d, 1,1,1-trifluoro-
- Methanesulfonic acid-d, trifluoro-
- Triflic acid-d
- Trifluoromethanesulfonic acid-d<sub>1</sub>
- Trifluoromethanesulphonic (2H)acid
- trifluoromethane(~2~H)sulfonic acid
- Trifluoromethanesulfonic acid-d
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Trifluoromethanesulfonic acid-D
CAS:Controlled Product<p>Triflic acid is a strong acid that reacts with nucleophiles such as water, alcohols, and amines. It is used in organic synthesis for desulfurization reactions, for example to convert thiophene to benzothiophene. Triflic acid is a synthetic chemical that is prepared by the reaction of sulfur trioxide with chlorotrifluoroethanesulfonyl fluoride. The protonation of the triflic acid molecule generates a sulfide anion. This anion then reacts with a nucleophile (e.g., chloride ion) to generate a chloride anion and regenerate the triflic acid molecule, which can then react again with another nucleophile. The reaction mechanism is shown below: HSOClF + NH3 → HSOClF + NH2Cl HSOClF + Cl- → HSO-Cl- + Cl The reaction mechanism for this process is shown below: HSOCl</p>Formula:CDF3O3SPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:151.08 g/mol

