CAS 6619-10-9
:1,2,3,4-tetra-O-acetyl-6-O-[(4-methylphenyl)sulfonyl]hexopyranose
Description:
1,2,3,4-Tetra-O-acetyl-6-O-[(4-methylphenyl)sulfonyl]hexopyranose is a complex organic compound characterized by its sugar backbone, specifically a hexopyranose structure, which is a six-membered cyclic form of a monosaccharide. The presence of four acetyl groups indicates that the hydroxyl groups on the sugar are acetylated, enhancing the compound's stability and solubility in organic solvents. The sulfonyl group, attached to the 6-position of the sugar, is derived from 4-methylphenylsulfonyl, which contributes to the compound's reactivity and potential applications in organic synthesis, particularly in glycosylation reactions. This compound is typically used in carbohydrate chemistry and may serve as an intermediate in the synthesis of more complex glycosides or oligosaccharides. Its molecular structure suggests it may exhibit specific stereochemical properties, influencing its interactions in biological systems. As with many acetylated sugars, it may also show varying degrees of solubility in polar and non-polar solvents, making it versatile for various chemical applications.
Formula:C21H26O12S
InChI:InChI=1/C21H26O12S/c1-11-6-8-16(9-7-11)34(26,27)28-10-17-18(29-12(2)22)19(30-13(3)23)20(31-14(4)24)21(33-17)32-15(5)25/h6-9,17-21H,10H2,1-5H3
SMILES:Cc1ccc(cc1)S(=O)(=O)OCC1C(C(C(C(OC(=O)C)O1)OC(=O)C)OC(=O)C)OC(=O)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,2,3,4-Tetra-O-acetyl-6-O-tosyl-b-D-glucopyranose
CAS:<p>The tetra-acetyl-6-tosyl-b-D-glucopyranose is a modification of the natural 1,2,3,4-tetra-O-acetyl-6-O-tosyl--D glucopyranose. It is synthesized by reacting the 1,2,3,4 tetra acetyl b glucopyranose with tosyl chloride and anhydrous pyridine in dry dichloromethane. The product is purified by column chromatography on silica gel using a solvent system consisting of ethyl acetate and methanol. The yield of this reaction is about 60%.<br>The molecular weight of this compound is 876.7 g/mol and its melting point is 253°C. The CAS No. for this compound is 661910-9 and its IUPAC name is (1R*, 2S*, 4R*)-1,2,</p>Formula:C21H26O12SPurity:Min. 95%Color and Shape:White PowderMolecular weight:502.49 g/mol
