CAS 6619-97-2
:Xylopic acid
Description:
Xylopic acid, with the CAS number 6619-97-2, is a naturally occurring organic compound primarily derived from the plant genus *Xylopia*, which is known for its aromatic fruits. This compound is classified as a fatty acid and is characterized by its unique structure, which includes a long hydrocarbon chain and a carboxylic acid functional group. Xylopic acid is typically a white to pale yellow solid at room temperature and is soluble in organic solvents but has limited solubility in water. It exhibits various biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmacological research. Additionally, xylopic acid can be involved in the synthesis of other chemical compounds and may serve as a precursor in the production of bioactive molecules. Its potential applications in the food and cosmetic industries are also being explored due to its natural origin and beneficial properties. Overall, xylopic acid represents a compound with significant potential in both scientific research and practical applications.
Formula:C22H32O4
InChI:InChI=1S/C22H32O4/c1-13-15-6-7-17-20(3)9-5-10-21(4,19(24)25)16(20)8-11-22(17,12-15)18(13)26-14(2)23/h15-18H,1,5-12H2,2-4H3,(H,24,25)/t15-,16+,17+,18-,20-,21-,22-/m1/s1
InChI key:InChIKey=AQBQBBLJTDSVLC-XNAIKIDQSA-N
SMILES:O(C(C)=O)[C@H]1[C@]23[C@]([C@@]4(C)[C@](CC2)([C@@](C(O)=O)(C)CCC4)[H])(CC[C@](C3)(C1=C)[H])[H]
Synonyms:- Kaur-16-en-18-oic acid, 15-(acetyloxy)-, (4α,15β)-
- Xylopic acid
- 1H-2,10a-Ethanophenanthrene, kaur-16-en-18-oic acid deriv.
- (4α,15β)-15-(Acetyloxy)kaur-16-en-18-oic acid
- Kaur-16-en-18-oic acid, 15β-hydroxy-, acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Xylopic acid
CAS:Xylopic acid is a useful organic compound for research related to life sciences. The catalog number is T124446 and the CAS number is 6619-97-2.Formula:C22H32O4Color and Shape:SolidMolecular weight:360.494Xylopic acid
CAS:Xylopic acid is a bioactive compound, which is a diterpenoid isolated from the plant species Xylopia aethiopica. This compound is derived primarily from the fruits of the plant, often referred to as the African pepper or grains of Selim. Xylopic acid exhibits its mode of action by interacting with various biological pathways, including anti-inflammatory and antimicrobial processes, as well as modulating specific cellular receptors and enzymatic activities.Formula:C22H32O4Purity:Min. 95%Molecular weight:360.49 g/mol

