CAS 66191-23-9

6-chloro-2-(methylsulfanyl)-7H-purine

Description:

6-Chloro-2-(methylsulfanyl)-7H-purine is a purine derivative characterized by the presence of a chlorine atom at the 6-position and a methylthio group at the 2-position of the purine ring. This compound exhibits properties typical of purines, including potential biological activity, as purines are fundamental components of nucleic acids and play critical roles in cellular processes. The chlorine substituent can influence the compound's reactivity and solubility, while the methylthio group may enhance its lipophilicity and biological interactions. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, due to its structural features, it may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. The compound's CAS number, 66191-23-9, allows for easy identification in chemical databases, facilitating research and application in various scientific fields. Overall, 6-chloro-2-(methylsulfanyl)-7H-purine represents a unique chemical entity with potential implications in biochemistry and pharmacology.

Formula: C₆H₅ClN₄S

InChI: InChI=1/C6H5ClN4S/c1-12-6-10-4(7)3-5(11-6)9-2-8-3/h2H,1H3,(H,8,9,10,11)

SMILES: CSc1nc(c2c(ncn2)[nH]1)Cl

Synonyms:

• 7H-purine, 6-chloro-2-(methylthio)-

6-Chloro-2-(methylthio)-7H-purine

CAS: 66191-23-9

Formula: C₆H₅ClN₄S

Molecular weight: 200.6487

Ref: IN-DA00FAG4

2-Methylthio-6-chloropurine

CAS: 66191-23-9

Ref: 7W-GN0936

2-Methylthio-6-chloropurine

CAS: 66191-23-9

2-Methylthio-6-chloropurine riboside is a nucleotide analog that is used as a substrate to study the enzymatic modification of RNA. The compound has been synthesized by reacting 2-methylthio-6-chloropurine with ribose and purine bases in a postsynthetic modification. To detect the product, 2-methylthio-6-chloropurine riboside was labeled with 32P and then detected using mass spectrometry. In order to identify the structure of this compound, it was subjected to chromatography and spectroscopy. This process allowed for the identification of 2-methylthio-6-chloropurine riboside as an analog of N6 methyladenosine.

Formula: C₆H₅CIN₄S

Purity: Min. 95%

Molecular weight: 304.11 g/mol

Ref: 3D-NM29024