CAS 6620-41-3
:diethyl diimidotricarbonate
Description:
Diethyl diimidotricarbonate, with the CAS number 6620-41-3, is a chemical compound characterized by its structure, which includes two ethyl groups and three carbonate functional groups. This compound is typically a colorless to pale yellow liquid and is known for its moderate volatility. It exhibits properties typical of carbonate esters, such as being a good solvent and having potential applications in organic synthesis and as a reagent in various chemical reactions. Diethyl diimidotricarbonate is also recognized for its ability to act as a carbonylating agent, which can facilitate the introduction of carbonyl groups into organic molecules. Safety considerations are important when handling this compound, as it may pose risks such as irritation to the skin and eyes, and appropriate protective measures should be taken. Its reactivity and functional groups make it a valuable intermediate in the synthesis of more complex organic compounds.
Formula:C7H12N2O5
InChI:InChI=1/C7H12N2O5/c1-3-13-6(11)8-5(10)9-7(12)14-4-2/h3-4H2,1-2H3,(H2,8,9,10,11,12)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
