CAS 6620-80-0
:6,7-dichloro-3-[3-({3-[(diethylamino)methyl]-4-hydroxyphenyl}amino)-2-hydroxypropyl]quinazolin-4(3H)-one
Description:
6,7-Dichloro-3-[3-({3-[(diethylamino)methyl]-4-hydroxyphenyl}amino)-2-hydroxypropyl]quinazolin-4(3H)-one is a synthetic organic compound characterized by its complex structure, which includes a quinazolinone core substituted with multiple functional groups. The presence of dichloro groups indicates potential reactivity and influences its biological activity. The compound features a diethylamino group, which can enhance solubility and bioavailability, making it relevant in pharmaceutical applications. The hydroxyl groups contribute to its polarity and may participate in hydrogen bonding, affecting its interaction with biological targets. This compound is often studied for its potential therapeutic effects, particularly in the context of cancer research, due to its ability to inhibit specific enzymes or pathways involved in tumor growth. Its molecular structure suggests it may exhibit a range of pharmacological properties, including anti-cancer activity, although specific biological activities would depend on further empirical studies. As with many synthetic compounds, safety and toxicity profiles are essential considerations in its application.
Formula:C22H26Cl2N4O3
InChI:InChI=1/C22H26Cl2N4O3/c1-3-27(4-2)11-14-7-15(5-6-21(14)30)25-10-16(29)12-28-13-26-20-9-19(24)18(23)8-17(20)22(28)31/h5-9,13,16,25,29-30H,3-4,10-12H2,1-2H3
SMILES:CCN(CC)Cc1cc(ccc1O)NCC(Cn1cnc2cc(c(cc2c1=O)Cl)Cl)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N-(Propan-2-yl)benzenecarbonimidoyl chloride
CAS:<p>N-(Propan-2-yl)benzenecarbonimidoyl chloride (PCI) is a synthetic, water-soluble drug that is used to treat anaerobic infections. PCI binds to the imidoyl group of bacterial enzymes, such as penicillinase and beta-lactamase, and inhibits their activity. It has been shown that PCI has an affinity for copper ions in the crystallographic analysis. This affinity can be optimized by changing the substituents on the phenyl ring to increase affinity for copper ions. The oxadiazoles and hydroxyalkyl groups are also being considered for optimization of this compound. PCI has been shown to inhibit the growth of various bacteria in screening tests with a shift in its absorption spectrum.</p>Formula:C10H12ClNPurity:Min. 95%Molecular weight:181.66 g/mol
