CAS 6621-48-3
:Piperidine, 2-(2,2-dicyclohexylethyl)-, hydrochloride (1:1)
Description:
Piperidine, 2-(2,2-dicyclohexylethyl)-, hydrochloride (1:1), with the CAS number 6621-48-3, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a dicyclohexylethyl substituent, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in aqueous solutions. The presence of the dicyclohexyl group may influence its lipophilicity and biological activity, making it of interest in medicinal chemistry and pharmacology. Piperidine derivatives are known for their diverse applications, including use as intermediates in the synthesis of pharmaceuticals and agrochemicals. The hydrochloride form often facilitates easier handling and dosing in laboratory and clinical settings. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are in place.
Formula:C19H35N·ClH
InChI:InChI=1S/C19H35N.ClH/c1-3-9-16(10-4-1)19(17-11-5-2-6-12-17)15-18-13-7-8-14-20-18;/h16-20H,1-15H2;1H
InChI key:InChIKey=IUISNHKIKKJZCK-UHFFFAOYSA-N
SMILES:C(CC1CCCCN1)(C2CCCCC2)C3CCCCC3.Cl
Synonyms:- Piperidine, 2-(2,2-dicyclohexylethyl)-, hydrochloride
- Perhexiline hydrochloride
- Piperidine, 2-(2,2-dicyclohexylethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
