CymitQuimica logo

CAS 6621-92-7

:

2(3H)-Furanone, 3-[(2,4-dihydroxyphenyl)methylene]-5-(4-methoxyphenyl)-

Description:
2(3H)-Furanone, 3-[(2,4-dihydroxyphenyl)methylene]-5-(4-methoxyphenyl)-, with CAS number 6621-92-7, is an organic compound characterized by its furanone core structure, which is a five-membered lactone containing a carbonyl group. This compound features multiple functional groups, including hydroxyl (-OH) groups and a methoxy (-OCH3) group, contributing to its potential reactivity and solubility in various solvents. The presence of the dihydroxyphenyl and methoxyphenyl substituents suggests that it may exhibit interesting biological activities, possibly including antioxidant or antimicrobial properties. The compound's structure allows for various intermolecular interactions, such as hydrogen bonding, which can influence its physical properties, including melting point and solubility. Additionally, the compound may be of interest in the fields of medicinal chemistry and materials science due to its potential applications in drug development or as a precursor for synthesizing more complex molecules. Overall, its unique structural features make it a subject of interest for further research and exploration.
Formula:C18H14O5
InChI:InChI=1/C18H14O5/c1-22-15-6-3-11(4-7-15)17-9-13(18(21)23-17)8-12-2-5-14(19)10-16(12)20/h2-10,19-20H,1H3/b13-8-
Synonyms:
  • 2(3H)-Furanone, 3-[(2,4-dihydroxyphenyl)methylene]-5-(4-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • ALR-6

    CAS:
    <p>ALR-6, an antagonist of the 5-lipoxygenase (5-LOX) activating protein FLAP, possesses anti-inflammatory properties. It significantly inhibits 5-LOX product formation (&gt;80%) in pro-inflammatory M1-MDM without substantially affecting direct inhibition of 5-LOX [1].</p>
    Formula:C18H14O5
    Color and Shape:Solid
    Molecular weight:310.3