CAS 66217-10-5
:6-hydroxynaphthalene-2-carboximidamide hydrochloride
Description:
6-Hydroxynaphthalene-2-carboximidamide hydrochloride, with the CAS number 66217-10-5, is a chemical compound characterized by its naphthalene structure, which features a hydroxyl group and a carboximidamide functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in different chemical applications. The presence of the hydroxyl group contributes to its potential reactivity, while the carboximidamide moiety may impart biological activity, making it of interest in pharmaceutical research. Its hydrochloride salt form enhances its stability and solubility, facilitating its use in laboratory settings. As with many organic compounds, it is essential to handle it with care, following appropriate safety protocols, as it may exhibit toxicity or irritant properties. Overall, 6-hydroxynaphthalene-2-carboximidamide hydrochloride serves as a valuable compound in organic synthesis and medicinal chemistry, warranting further investigation into its properties and potential applications.
Formula:C11H11ClN2O
InChI:InChI=1/C11H10N2O.ClH/c12-11(13)9-2-1-8-6-10(14)4-3-7(8)5-9;/h1-6,14H,(H3,12,13);1H
SMILES:c1cc(cc2ccc(cc12)O)C(=N)N.Cl
Synonyms:- 6-AMIDINO-2-NAPHTHOL, HYDROCHLORIDE
- 2-NaphthalenecarboxiMidaMide, 6-hydroxy-, Monohydrochloride
- 6-Hydroxynaphthalene-2-carboximidamide hydrochloride
- 6-Hydroxy-2-naphthalenecarboxiMidaMide Hydrochloride
- 6-Amidino-2-naphthol,hydrochloride ,98%
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
6-Amidino-2-naphthol Hydrochloride
CAS:Controlled ProductApplications A Nafamostat Mesylate (NM) (N210000) metabolite.
References Ookawara, S., et al.: Eur. J. Clin. Pharmacol., 51, 149 (1996), Cao, Y., et al.: Anal. Bioanal. Chem., 391, 1063 (2008)Formula:C11H10N2O·ClHColor and Shape:NeatMolecular weight:222.67

