CAS 66217-20-7

2-Bromo-6-n-butoxynaphthalene

Description:

2-Bromo-6-n-butoxynaphthalene is an organic compound characterized by its naphthalene backbone substituted with a bromine atom at the 2-position and a butoxy group at the 6-position. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its aromatic properties due to the presence of the naphthalene structure. The bromine substitution introduces halogen reactivity, which can be exploited in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The butoxy group enhances the solubility of the compound in organic solvents, making it useful in various applications, including organic synthesis and materials science. Additionally, the presence of both the bromine and butoxy groups can influence the compound's electronic properties, potentially affecting its behavior in photochemical processes or as a ligand in coordination chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₁₄H₁₅BrO

InChI: InChI=1/C14H15BrO/c1-2-3-8-16-14-7-5-11-9-13(15)6-4-12(11)10-14/h4-7,9-10H,2-3,8H2,1H3

SMILES: CCCCOc1ccc2cc(ccc2c1)Br

Synonyms:

• 6-Bromo-2-Naphthyl Butyl Ether
• Naphthalene, 2-Bromo-6-Butoxy-
• 2-Bromo-6-Butoxynaphthalene

2-Bromo-6-butoxynaphthalene

CAS: 66217-20-7

Formula: C₁₄H₁₅BrO

Purity: 95%

Color and Shape: Solid

Molecular weight: 279.1723

Ref: IN-DA003GR3

2-Bromo-6-Butoxynaphthalene

CAS: 66217-20-7

2-Bromo-6-Butoxynaphthalene

Purity: 98%

Molecular weight: 279.17g/mol

Ref: 54-OR1010351

2-Bromo-6-n-butyloxynaphthalene

CAS: 66217-20-7

Formula: C₁₄H₁₅BrO

Purity: ≥95%

Color and Shape: No data available.

Molecular weight: 279.177

Ref: 10-F401134