CAS 6622-54-4

9-Carbazolepropionic acid

Description:

9-Carbazolepropionic acid is an organic compound characterized by its unique structure, which includes a carbazole moiety linked to a propionic acid group. This compound typically appears as a white to off-white solid and is known for its potential applications in pharmaceuticals and organic electronics due to its interesting electronic properties. The presence of the carbazole ring contributes to its stability and ability to participate in various chemical reactions, including those involving electron transfer. 9-Carbazolepropionic acid is also recognized for its potential as a building block in the synthesis of more complex organic molecules. Its solubility can vary depending on the solvent, and it may exhibit moderate to low solubility in water. Additionally, this compound may possess biological activity, making it a subject of interest in medicinal chemistry. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₁₅H₁₃NO₂

InChI: InChI=1/C15H13NO2/c17-15(18)9-10-16-13-7-3-1-5-11(13)12-6-2-4-8-14(12)16/h1-8H,9-10H2,(H,17,18)

SMILES: c1ccc2c(c1)c1ccccc1n2CCC(=O)O

Synonyms:

• 3-(9H-carbazol-9-yl)propanoic acid

9-CARBAZOLEPROPIONIC ACID

CAS: 6622-54-4

Formula: C₁₅H₁₃NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 239.2692

Ref: IN-DA00FE0T

3-(9H-Carbazol-9-Yl)Propanoic Acid

CAS: 6622-54-4

3-(9H-Carbazol-9-Yl)Propanoic Acid

Purity: 99%

Molecular weight: 239.27g/mol

Ref: 54-OR1025518

3-Carbazol-9-yl-propionic acid

CAS: 6622-54-4

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 239.2740020751953

Ref: 10-F042244

3-(9H-Carbazol-9-yl)propanoic Acid

Controlled Product

CAS: 6622-54-4

Applications 3-(9H-carbazol-9-yl)propanoic acid (cas# 6622-54-4) is a useful research chemical.

Formula: C₁₅H₁₃NO₂

Color and Shape: Neat

Molecular weight: 239.269

Ref: TR-H956178