CAS 6623-43-4

2-[(1-Phenylethyl)amino]ethanol

Description:

2-[(1-Phenylethyl)amino]ethanol, also known as phenylethylaminoethanol, is an organic compound characterized by its amino alcohol structure. It features a primary amine group and a hydroxyl group, which contribute to its reactivity and potential as a building block in organic synthesis. The presence of the phenylethyl group enhances its lipophilicity, allowing it to interact with biological membranes, which may influence its pharmacological properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in water and organic solvents, making it versatile for various applications in medicinal chemistry and biochemistry. The compound may exhibit biological activity, including potential effects on neurotransmitter systems, which warrants further investigation for therapeutic uses. Safety data indicates that, like many amines and alcohols, it should be handled with care due to potential irritant properties. Overall, 2-[(1-Phenylethyl)amino]ethanol is of interest in both academic research and industrial applications.

Formula: C₁₀H₁₅NO

InChI: InChI=1/C10H15NO/c1-9(11-7-8-12)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3

SMILES: CC(c1ccccc1)NCCO

Synonyms:

• 2-[(Phenylethyl)amino]ethanol
• Ethanol, 2-[(1-phenylethyl)amino]-
• 2-[(1-Phenylethyl)amino]ethanol

2-((1-Phenylethyl)amino)ethanol

CAS: 6623-43-4

Formula: C₁₀H₁₅NO

Molecular weight: 165.2322

Ref: IN-DA003G7L

2-(1-Phenyl-ethylamino)-ethanol

CAS: 6623-43-4

2-(1-Phenyl-ethylamino)-ethanol is an organic compound that is used as a catalyst. The compound is produced industrially by the reaction of formaldehyde with phenethylamine, followed by hydrogenation and hydrolysis. 2-(1-Phenyl-ethylamino)-ethanol can be used as a catalyst in the synthesis of oxazolidines, ketones, and other compounds containing aldehydes or carboxylic acids. It also has basic properties, which means it will react with acidic compounds to produce salts. 2-(1-Phenyl-ethylamino)-ethanol binds to amino alcohols and pyrroles through hydrogen bonding interactions.

Formula: C₁₀H₁₅NO

Purity: Min. 95%

Molecular weight: 165.24 g/mol

Ref: 3D-GAA62343