CymitQuimica logo

CAS 6623-56-9

:

1-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]-3,5,7-triaza-1-azoniatricyclo[3.3.1.1~3,7~]decane

Description:
1-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]-3,5,7-triaza-1-azoniatricyclo[3.3.1.1^3,7]decane, commonly referred to by its CAS number 6623-56-9, is a complex organic compound characterized by its unique tricyclic structure and the presence of multiple functional groups. This compound features a triaza framework, which incorporates three nitrogen atoms within its cyclic structure, contributing to its potential biological activity. The presence of a 3,4-dihydroxyphenyl group suggests that it may exhibit antioxidant properties, while the 2-oxoethyl moiety indicates potential reactivity due to the carbonyl group. The azonium ion suggests that the compound may possess cationic characteristics, which can influence its solubility and interaction with biological systems. Overall, this compound's structural complexity and functional groups may render it of interest in medicinal chemistry, particularly in the development of pharmaceuticals or as a biochemical probe. Further studies would be necessary to elucidate its specific properties and potential applications.
Formula:C14H19N4O3
InChI:InChI=1/C14H18N4O3/c19-12-2-1-11(3-13(12)20)14(21)4-18-8-15-5-16(9-18)7-17(6-15)10-18/h1-3H,4-10H2,(H-,19,20,21)/p+1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.