CymitQuimica logo

CAS 6624-23-3

:

anthracen-9-ylacetic acid

Description:
Anthracen-9-ylacetic acid, with the CAS number 6624-23-3, is an organic compound characterized by its structure, which includes an anthracene moiety attached to an acetic acid group at the 9-position. This compound typically appears as a crystalline solid and is known for its aromatic properties due to the presence of the anthracene ring system. It exhibits moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water. Anthracen-9-ylacetic acid can participate in various chemical reactions, including esterification and acylation, making it useful in organic synthesis and materials science. Its unique structure allows it to exhibit interesting photophysical properties, which can be leveraged in applications such as organic electronics and fluorescence. Additionally, the compound may have potential biological activities, although specific studies on its pharmacological effects may be limited. Overall, anthracen-9-ylacetic acid is a valuable compound in both research and industrial applications due to its distinctive chemical characteristics.
Formula:C16H12O2
InChI:InChI=1/C16H12O2/c17-16(18)10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-9H,10H2,(H,17,18)
SMILES:c1ccc2c(c1)cc1ccccc1c2CC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.