CAS 6624-49-3
:3-Isoquinolinecarboxylic acid
Description:
3-Isoquinolinecarboxylic acid, with the CAS number 6624-49-3, is an organic compound characterized by its isoquinoline structure, which features a bicyclic aromatic system. This compound contains a carboxylic acid functional group (-COOH) at the 3-position of the isoquinoline ring, contributing to its acidic properties. It is typically a white to off-white crystalline solid that is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the carboxylic acid group allows it to participate in various chemical reactions, including esterification and amidation. 3-Isoquinolinecarboxylic acid is of interest in medicinal chemistry and pharmacology due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Additionally, it can serve as a building block in the synthesis of more complex organic molecules. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.
Formula:C10H9NO3
InChI:InChI=1/C10H7NO2.H2O/c12-10(13)9-5-7-3-1-2-4-8(7)6-11-9;/h1-6H,(H,12,13);1H2
SMILES:c1ccc2cnc(cc2c1)C(=O)O.O
Synonyms:- Isoquinoline-3-Carboxylic Acid
- Isoquinoline-3-Carboxylic Acid Hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Isoquinolinecarboxylic acid
CAS:Formula:C10H7NO2Purity:97%Color and Shape:SolidMolecular weight:173.1681Isoquinoline-3-carboxylic acid
CAS:Isoquinoline-3-carboxylic acidFormula:C10H7NO2Purity:≥95%Color and Shape: white to off-white solidMolecular weight:173.17g/molIsoquinoline-3-carboxylic Acid
CAS:Formula:C10H7NO2Purity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:173.17Isoquinoline-3-carboxylic acid
CAS:Formula:C10H7NO2Purity:98%Color and Shape:Solid, PowderMolecular weight:173.1713-Isoquinolinecarboxylic acid
CAS:3-Isoquinolinecarboxylic acid is a molecule with a reactive group that can form cyclic structures. It has been shown that 3-Isoquinolinecarboxylic acid is an apoptotic agent in human macrophages and induces the release of picolinic acid from these cells. This molecule also has a high affinity for α7 nicotinic acetylcholine receptors, which are present on the surface of nerve cells. 3-Isoquinolinecarboxylic acid can be synthesized by condensing picolinic acid, an aromatic aminoacid, with an appropriate amine. The synthesis of this heterocycle is catalyzed by an enzyme called quinolinate synthase. The product of this reaction is oxidized to form 3-isoquinolyl carboxylic acid. The final step in the synthesis involves the oxidative cleavage of a disulfide bond using hydrogen peroxide, yielding 3-isoquinolyFormula:C10H7NO2Purity:Min. 95%Molecular weight:173.17 g/mol




