CAS 6624-49-3

3-Isoquinolinecarboxylic acid

Description:

3-Isoquinolinecarboxylic acid, with the CAS number 6624-49-3, is an organic compound characterized by its isoquinoline structure, which features a bicyclic aromatic system. This compound contains a carboxylic acid functional group (-COOH) at the 3-position of the isoquinoline ring, contributing to its acidic properties. It is typically a white to off-white crystalline solid that is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the carboxylic acid group allows it to participate in various chemical reactions, including esterification and amidation. 3-Isoquinolinecarboxylic acid is of interest in medicinal chemistry and pharmacology due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Additionally, it can serve as a building block in the synthesis of more complex organic molecules. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.

Formula: C₁₀H₉NO₃

InChI: InChI=1/C10H7NO2.H2O/c12-10(13)9-5-7-3-1-2-4-8(7)6-11-9;/h1-6H,(H,12,13);1H2

SMILES: c1ccc2cnc(cc2c1)C(=O)O.O

Synonyms:

• Isoquinoline-3-Carboxylic Acid
• Isoquinoline-3-Carboxylic Acid Hydrate

3-Isoquinolinecarboxylic acid

CAS: 6624-49-3

Formula: C₁₀H₇NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 173.1681

Ref: IN-DA00FASO

Isoquinoline-3-carboxylic acid

CAS: 6624-49-3

Isoquinoline-3-carboxylic acid

Formula: C₁₀H₇NO₂

Purity: ≥95%

Color and Shape: white to off-white solid

Molecular weight: 173.17g/mol

Ref: 54-OR16580

Isoquinoline-3-carboxylic Acid

CAS: 6624-49-3

Formula: C₁₀H₇NO₂

Purity: >95.0%(T)(HPLC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 173.17

Ref: 3B-I1246

Isoquinoline-3-carboxylic acid

CAS: 6624-49-3

Formula: C₁₀H₇NO₂

Purity: 98%

Color and Shape: Solid, Powder

Molecular weight: 173.171

Ref: 10-F066337

3-Isoquinolinecarboxylic acid

CAS: 6624-49-3

3-Isoquinolinecarboxylic acid is a molecule with a reactive group that can form cyclic structures. It has been shown that 3-Isoquinolinecarboxylic acid is an apoptotic agent in human macrophages and induces the release of picolinic acid from these cells. This molecule also has a high affinity for α7 nicotinic acetylcholine receptors, which are present on the surface of nerve cells. 3-Isoquinolinecarboxylic acid can be synthesized by condensing picolinic acid, an aromatic aminoacid, with an appropriate amine. The synthesis of this heterocycle is catalyzed by an enzyme called quinolinate synthase. The product of this reaction is oxidized to form 3-isoquinolyl carboxylic acid. The final step in the synthesis involves the oxidative cleavage of a disulfide bond using hydrogen peroxide, yielding 3-isoquinoly

Formula: C₁₀H₇NO₂

Purity: Min. 95%

Molecular weight: 173.17 g/mol

Ref: 3D-FI11973