CAS 6625-20-3

4-(dimethylamino)-3,10,12,12a-tetrahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide hydrochloride (1:1)

Description:

4-(Dimethylamino)-3,10,12,12a-tetrahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide hydrochloride (1:1), with CAS number 6625-20-3, is a complex organic compound characterized by its polycyclic structure, which includes multiple hydroxyl groups and a carboxamide functional group. This compound is known for its potential applications in various fields, including pharmaceuticals and materials science, due to its unique electronic properties and ability to form stable complexes. The presence of dimethylamino groups enhances its solubility and reactivity, making it suitable for various chemical reactions. Additionally, the hydrochloride salt form indicates that it is a protonated species, which can influence its stability and solubility in aqueous environments. The compound's intricate structure contributes to its biological activity, and it may exhibit properties such as fluorescence or photochemical reactivity, which are of interest in research and development. However, specific safety and handling guidelines should be followed due to its complex nature and potential biological effects.

Formula: C₂₁H₂₃ClN₂O₇

InChI: InChI=1/C21H22N2O7.ClH/c1-23(2)15-10-7-9-6-8-4-3-5-11(24)12(8)16(25)13(9)18(27)21(10,30)19(28)14(17(15)26)20(22)29;/h3-5,9-10,15,24,26-27,30H,6-7H2,1-2H3,(H2,22,29);1H

SMILES: CN(C)C1C2CC3Cc4cccc(c4C(=O)C3=C(C2(C(=O)C(=C1O)C(=N)O)O)O)O.Cl

Synonyms:

• Sancycline Hydrochloride

(4S,4aS,5aR,12aS)-4-(Dimethylamino)-3,10,12,12a-tetrahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide hydrochloride

CAS: 6625-20-3

(4S,4aS,5aR,12aS)-4-(Dimethylamino)-3,10,12,12a-tetrahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide hydrochloride

Purity: 99%

Molecular weight: 450.88g/mol

Ref: 54-OR1066161

Sancycline Hydrochloride

Controlled Product

CAS: 6625-20-3

Formula: C₂₁H₂₂N₂O₇·ClH

Color and Shape: Neat

Molecular weight: 450.87

Ref: TR-S111500

Sancycline-13C-d3 Hydrochloride

Controlled Product

CAS: 1335150-20-3, 6625-20-3

Formula: CC₂₀D₃H₁₉N₂O₇·HCl

Color and Shape: Neat

Molecular weight: 454.881

Ref: TR-S111502

Sancycline hydrochloride

CAS: 6625-20-3

Sancycline hydrochloride is a tetracycline antibiotic, which is derived from the natural fermentation process of Streptomyces bacteria. The mechanism of action involves the inhibition of protein synthesis by bindin directly to the 30S ribosomal subunit, thereby preventing the attachment of aminoacyl-tRNA to the A site of the ribosome. This action effectively halts the growth of bacteria by impeding protein production, making it bacteriostatic rather than bactericidal.

Formula: C₂₁H₂₃ClN₂O₇

Purity: Min. 95%

Molecular weight: 450.87 g/mol

Ref: 3D-AS27790