
CAS 6625-20-3
:4-(dimethylamino)-3,10,12,12a-tetrahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide hydrochloride (1:1)
Description:
4-(Dimethylamino)-3,10,12,12a-tetrahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide hydrochloride (1:1), with CAS number 6625-20-3, is a complex organic compound characterized by its polycyclic structure, which includes multiple hydroxyl groups and a carboxamide functional group. This compound is known for its potential applications in various fields, including pharmaceuticals and materials science, due to its unique electronic properties and ability to form stable complexes. The presence of dimethylamino groups enhances its solubility and reactivity, making it suitable for various chemical reactions. Additionally, the hydrochloride salt form indicates that it is a protonated species, which can influence its stability and solubility in aqueous environments. The compound's intricate structure contributes to its biological activity, and it may exhibit properties such as fluorescence or photochemical reactivity, which are of interest in research and development. However, specific safety and handling guidelines should be followed due to its complex nature and potential biological effects.
Formula:C21H23ClN2O7
InChI:InChI=1/C21H22N2O7.ClH/c1-23(2)15-10-7-9-6-8-4-3-5-11(24)12(8)16(25)13(9)18(27)21(10,30)19(28)14(17(15)26)20(22)29;/h3-5,9-10,15,24,26-27,30H,6-7H2,1-2H3,(H2,22,29);1H
SMILES:CN(C)C1C2CC3Cc4cccc(c4C(=O)C3=C(C2(C(=O)C(=C1O)C(=N)O)O)O)O.Cl
Synonyms:- Sancycline Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(4S,4aS,5aR,12aS)-4-(Dimethylamino)-3,10,12,12a-tetrahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide hydrochloride
CAS:(4S,4aS,5aR,12aS)-4-(Dimethylamino)-3,10,12,12a-tetrahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide hydrochloridePurity:99%Molecular weight:450.88g/molSancycline Hydrochloride
CAS:Controlled ProductFormula:C21H22N2O7·ClHColor and Shape:NeatMolecular weight:450.87Sancycline-13C-d3 Hydrochloride
CAS:Controlled ProductFormula:CC20D3H19N2O7·HClColor and Shape:NeatMolecular weight:454.881Sancycline hydrochloride
CAS:Sancycline hydrochloride is a tetracycline antibiotic, which is derived from the natural fermentation process of Streptomyces bacteria. The mechanism of action involves the inhibition of protein synthesis by bindin directly to the 30S ribosomal subunit, thereby preventing the attachment of aminoacyl-tRNA to the A site of the ribosome. This action effectively halts the growth of bacteria by impeding protein production, making it bacteriostatic rather than bactericidal.Formula:C21H23ClN2O7Purity:Min. 95%Molecular weight:450.87 g/mol


