CAS 6625-78-1

2-(benzyloxy)propanoic acid

Description:

2-(Benzyloxy)propanoic acid, also known as benzyloxypropanoic acid, is an organic compound characterized by its structure, which features a propanoic acid backbone with a benzyloxy group attached to the second carbon. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic benzyloxy group. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Its molecular structure contributes to its potential applications in pharmaceuticals and organic synthesis, where it may serve as an intermediate or a building block for more complex molecules. Additionally, the compound's reactivity can be influenced by the substituents on the aromatic ring, making it a subject of interest in medicinal chemistry and material science. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₀H₁₂O₃

InChI: InChI=1/C10H12O3/c1-8(10(11)12)13-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12)

SMILES: CC(C(=O)O)OCc1ccccc1

2-(Benzyloxy)propanoic acid

CAS: 6625-78-1

2-(Benzyloxy)propanoic acid is a carboxylic acid that is used in biotechnology as a substrate for the production of optically pure carboxylic acids. It can be converted to pure hydroxyapatite, which is an important component of bone grafts and dentures. The microbial synthesis of 2-(benzyloxy)propanoic acid has been studied extensively. The n-terminal amino group can be removed by reduction with sodium sulfate or sodium borohydride, and the resulting alcohols can be converted to esters either enzymatically or with organic acids. 2-(Benzyloxy)propanoic acid also reacts with dodecyl mercaptan to give the corresponding dodecyl sulfate.

Formula: C₁₀H₁₂O₃

Purity: Min. 95%

Molecular weight: 180.2 g/mol

Ref: 3D-GAA62578