CAS 6626-07-9
:3-(2-chlorophenyl)-7-hydroxy-4H-chromen-4-one
Description:
3-(2-chlorophenyl)-7-hydroxy-4H-chromen-4-one, also known as a flavonoid compound, exhibits several notable characteristics. This compound features a chromone backbone, which is a bicyclic structure consisting of a benzene ring fused to a pyrone ring. The presence of the 2-chlorophenyl group introduces a chlorine substituent that can influence its biological activity and solubility. The hydroxyl group at the 7-position enhances its potential for hydrogen bonding and may contribute to its antioxidant properties. This compound is often studied for its pharmacological effects, including anti-inflammatory, antimicrobial, and anticancer activities. Its solubility can vary depending on the solvent used, and it may exhibit UV-visible absorption characteristics typical of flavonoids. Additionally, the structural features of this compound suggest potential interactions with various biological targets, making it of interest in medicinal chemistry and natural product research. Overall, 3-(2-chlorophenyl)-7-hydroxy-4H-chromen-4-one represents a significant class of compounds with diverse applications in health and disease management.
Formula:C13H11ClN2O3
InChI:InChI=1/C15H9ClO3/c16-13-4-2-1-3-10(13)12-8-19-14-7-9(17)5-6-11(14)15(12)18/h1-8,17H
Synonyms:- 4H-1-benzopyran-4-one, 3-(2-chlorophenyl)-7-hydroxy-
- 3-(2-Chlorophenyl)-7-hydroxy-4H-chromen-4-one
- 4-Chloro-2-[(6-methoxy-3-pyridinyl)amino] benzoic acid
- UYMKSOUAEXWFOT-UHFFFAOYSA-N
- 5-(2-Carboxy-5-chloroanilino)-2-methoxypyridine
- Benzoic acid, 4-chloro-2-[(6-methoxy-3-pyridinyl)amino]-
- N-(2-Carboxy-5-chlorophenyl)-6-methoxy-3-pyridinamine
- 4-chloro-2-(6-methoxypyridin-3-ylamino)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
