CymitQuimica logo

CAS 6626-36-4

:

1,1'-iminobis[3-(prop-2-en-1-yloxy)propan-2-ol]

Description:
1,1'-Iminobis[3-(prop-2-en-1-yloxy)propan-2-ol], with the CAS number 6626-36-4, is an organic compound characterized by its dual functional groups that include both an imine and ether functionalities. This compound features a central imine linkage connecting two identical moieties of 3-(prop-2-en-1-yloxy)propan-2-ol, which contributes to its reactivity and potential applications in polymer chemistry and as a crosslinking agent. The presence of the prop-2-en-1-yloxy groups indicates that it can undergo polymerization reactions, making it useful in the synthesis of various polymeric materials. Additionally, the hydroxyl groups present in the structure enhance its solubility in polar solvents and may facilitate hydrogen bonding, influencing its physical properties. The compound is likely to exhibit moderate stability under standard conditions but may be sensitive to heat and light, which can promote polymerization or degradation. Overall, its unique structure and functional groups make it a versatile compound in chemical synthesis and materials science.
Formula:C12H23NO4
InChI:InChI=1/C12H23NO4/c1-3-5-16-9-11(14)7-13-8-12(15)10-17-6-4-2/h3-4,11-15H,1-2,5-10H2
SMILES:C=CCOCC(CNCC(COCC=C)O)O
Synonyms:
  • 1,1'-Iminobis[3-(allyloxy)propan-2-ol]
  • 2-Propanol, 1,1'-Iminobis[3-(2-Propen-1-Yloxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.