CymitQuimica logo

CAS 66264-77-5

:

Sulfinalol

Description:
Sulfinalol, with the CAS number 66264-77-5, is a chemical compound that belongs to the class of sulfonamides. It is characterized by its sulfonyl group, which is typically associated with various biological activities. Sulfinalol is known for its potential use in medicinal chemistry, particularly as an antihypertensive agent, due to its ability to influence vascular smooth muscle relaxation. The compound exhibits a moderate level of solubility in water and organic solvents, which can affect its bioavailability and pharmacokinetics. Its molecular structure includes functional groups that contribute to its reactivity and interaction with biological targets. Additionally, sulfinalol may undergo metabolic transformations in the body, leading to various metabolites that could have distinct pharmacological effects. As with many sulfonamide derivatives, it is essential to consider its safety profile, including potential allergic reactions in sensitive individuals. Overall, sulfinalol represents a compound of interest in both pharmaceutical research and therapeutic applications.
Formula:C20H27NO4S
InChI:InChI=1S/C20H27NO4S/c1-14(4-5-15-6-9-17(25-2)10-7-15)21-13-19(23)16-8-11-18(22)20(12-16)26(3)24/h6-12,14,19,21-23H,4-5,13H2,1-3H3
InChI key:InChIKey=PAQZZCOZHPGCFW-UHFFFAOYSA-N
SMILES:C(CNC(CCC1=CC=C(OC)C=C1)C)(O)C2=CC(S(C)=O)=C(O)C=C2
Synonyms:
  • Benzenemethanol, 4-hydroxy-α-[[[3-(4-methoxyphenyl)-1-methylpropyl]amino]methyl]-3-(methylsulfinyl)-
  • Sulfinalol
  • 4-Hydroxy-α-[[[3-(4-methoxyphenyl)-1-methylpropyl]amino]methyl]-3-(methylsulfinyl)benzenemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Sulfinalol

    CAS:
    Sulfinalol is a compound that acts as an orally active β-adrenoceptor antagonist and directly induces vasodilation [1].
    Formula:C20H27NO4S
    Color and Shape:Solid
    Molecular weight:377.5