CAS 6627-22-1

methyl 6-chloropyrimidine-4-carboxylate

Description:

Methyl 6-chloropyrimidine-4-carboxylate is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. The presence of a chlorine atom at the 6-position and a carboxylate group at the 4-position contributes to its reactivity and potential applications in various chemical syntheses. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic characteristics. Methyl 6-chloropyrimidine-4-carboxylate is often utilized in medicinal chemistry and agrochemical research, serving as an intermediate in the synthesis of pharmaceuticals and biologically active compounds. Its reactivity can be attributed to the electrophilic nature of the chlorine atom and the carboxylate group, making it a valuable building block in organic synthesis. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₆H₅ClN₂O₂

InChI: InChI=1/C6H5ClN2O2/c1-11-6(10)4-2-5(7)9-3-8-4/h2-3H,1H3

SMILES: COC(=O)c1cc(Cl)ncn1

Methyl 6-chloropyrimidine-4-carboxylate

CAS: 6627-22-1

Formula: C₆H₅ClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 172.5691

Ref: IN-DA003RYG

Methyl 6-chloropyrimidine-4-carboxylate

CAS: 6627-22-1

Methyl 6-chloropyrimidine-4-carboxylate

Purity: 97%

Molecular weight: 172.5691g/mol

Ref: 54-OR18854

Methyl 6-chloropyrimidine-4-carboxylate

CAS: 6627-22-1

Formula: C₆H₅ClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 172.57

Ref: 10-F303229