CAS 6627-84-5

4-(cyclopent-2-enyl)phenol

Description:

4-(Cyclopent-2-enyl)phenol, with the CAS number 6627-84-5, is an organic compound characterized by a phenolic structure substituted with a cyclopent-2-enyl group at the para position. This compound typically exhibits properties associated with both phenols and alkenes, including potential antioxidant activity due to the presence of the hydroxyl (-OH) group. The cyclopent-2-enyl moiety introduces a degree of unsaturation and cyclic structure, which can influence its reactivity and stability. In terms of physical properties, it may be a solid or liquid at room temperature, depending on its specific molecular interactions and purity. The compound is likely to be soluble in organic solvents but may have limited solubility in water due to its hydrophobic characteristics. Its applications could span various fields, including materials science and organic synthesis, where it may serve as an intermediate or a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₁H₁₂O

InChI: InChI=1/C11H12O/c12-11-7-5-10(6-8-11)9-3-1-2-4-9/h1,3,5-9,12H,2,4H2

SMILES: C1=CC(CC1)c1ccc(cc1)O

Synonyms:

• 4-(Cyclopent-2-En-1-Yl)Phenol

4-Cyclopent-2-enyl-phenol

Controlled Product

CAS: 6627-84-5

Formula: C₁₁H₁₂O

Color and Shape: Neat

Molecular weight: 160.212

Ref: TR-B427313