CAS 6627-95-8

2-butoxy-5-nitropyridine

Description:

2-Butoxy-5-nitropyridine is an organic compound characterized by its pyridine ring, which is substituted at the second position with a butoxy group and at the fifth position with a nitro group. This compound typically appears as a yellow to brown liquid or solid, depending on its purity and temperature. It is known for its moderate polarity due to the presence of both the butoxy and nitro groups, which can influence its solubility in various solvents. The nitro group contributes to its potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and reductions. Additionally, 2-butoxy-5-nitropyridine may exhibit biological activity, which can be of interest in pharmaceutical research. Safety data indicates that, like many nitro compounds, it should be handled with care due to potential toxicity and environmental hazards. Proper storage and handling protocols are essential to mitigate risks associated with exposure.

Formula: C₉H₁₂N₂O₃

InChI: InChI=1/C9H12N2O3/c1-2-3-6-14-9-5-4-8(7-10-9)11(12)13/h4-5,7H,2-3,6H2,1H3

SMILES: CCCCOc1ccc(cn1)N(=O)=O

2-Butoxy-5-nitropyridine

CAS: 6627-95-8

Versatile small molecule scaffold

Formula: C₉H₁₂N₂O₃

Purity: Min. 95%

Molecular weight: 196.2 g/mol

Ref: 3D-GAA62795