CAS 66277-10-9
:D-Streptamine, O-3-deoxy-3-(methylamino)-β-L-arabinopyranosyl-(1→6)-O-[2,6-diamino-2,3,4,6,7-pentadeoxy-α-D-ribo-heptopyranosyl-(1→4)]-2-deoxy-
Description:
D-Streptamine, O-3-deoxy-3-(methylamino)-β-L-arabinopyranosyl-(1→6)-O-[2,6-diamino-2,3,4,6,7-pentadeoxy-α-D-ribo-heptopyranosyl-(1→4)]-2-deoxy- is a complex glycosylated aminoglycoside antibiotic. It is characterized by its intricate structure, which includes multiple sugar moieties and amino groups that contribute to its biological activity. The presence of the 3-deoxy-3-(methylamino) group enhances its interaction with bacterial ribosomes, thereby inhibiting protein synthesis. This compound is typically derived from natural sources and exhibits antibacterial properties, particularly against Gram-negative bacteria. Its unique glycosidic linkages and stereochemistry play a crucial role in its pharmacological efficacy and specificity. The CAS number 66277-10-9 allows for precise identification in chemical databases, facilitating research and development in medicinal chemistry. Overall, D-streptamine derivatives are significant in the field of antibiotic development, providing insights into structure-activity relationships and potential therapeutic applications.
Formula:C19H39N5O7
InChI:InChI=1/C19H39N5O7/c1-7(20)12-4-3-8(21)18(29-12)30-16-9(22)5-10(23)17(15(16)27)31-19-14(26)13(24-2)11(25)6-28-19/h7-19,24-27H,3-6,20-23H2,1-2H3
Synonyms:- D-Streptamine, O-3-deoxy-3-(methylamino)-β-L-arabinopyranosyl-(1→6)-O-[2,6-diamino-2,3,4,6,7-pentadeoxy-α-D-ribo-heptopyranosyl-(1→4)]-2-deoxy-
- 4''-Demethylgentamicin C2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4"-Demethylgentamicin C2
CAS:<p>4"-Demethylgentamicin C2 exhibits activity against both Gram-positive and Gram-negative bacteria.</p>Formula:C19H39N5O7Color and Shape:SolidMolecular weight:449.54
