CAS 6628-34-8

4-(4-methoxyphenyl)-7-(2-oxopropoxy)-2H-chromen-2-one

Description:

4-(4-Methoxyphenyl)-7-(2-oxopropoxy)-2H-chromen-2-one, also known by its CAS number 6628-34-8, is a synthetic organic compound belonging to the class of flavonoids, specifically a coumarin derivative. This compound features a chromenone core, characterized by a fused benzene and α-pyrone ring system, which contributes to its potential biological activities. The presence of the methoxyphenyl group enhances its lipophilicity, while the oxopropoxy substituent may influence its reactivity and interaction with biological targets. This compound is of interest in medicinal chemistry due to its potential antioxidant, anti-inflammatory, and anticancer properties, which are common among flavonoids. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important for applications in pharmaceuticals and research. As with many organic compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles may not be fully characterized.

Formula: C₁₉H₁₆O₅

InChI: InChI=1/C19H16O5/c1-12(20)11-23-15-7-8-16-17(10-19(21)24-18(16)9-15)13-3-5-14(22-2)6-4-13/h3-10H,11H2,1-2H3

SMILES: CC(=O)COc1ccc2c(cc(=O)oc2c1)c1ccc(cc1)OC

Synonyms:

• 2H-1-benzopyran-2-one, 4-(4-methoxyphenyl)-7-(2-oxopropoxy)-

Ethyl 2-(2-methyl-1H-indol-3-yl)-2-oxoacetate

CAS: 6628-34-8

Versatile small molecule scaffold

Formula: C₁₃H₁₃NO₃

Purity: Min. 95%

Molecular weight: 231.25 g/mol

Ref: 3D-GAA62834