CAS 6628-40-6
:4-{[(2-bromophenyl)carbonyl]carbonohydrazonoyl}-2-methoxyphenyl 2,4-dichlorobenzoate
Description:
The chemical substance known as "4-{[(2-bromophenyl)carbonyl]carbonohydrazonoyl}-2-methoxyphenyl 2,4-dichlorobenzoate," with the CAS number 6628-40-6, is a complex organic compound characterized by its multi-functional groups. It features a hydrazone linkage, which is indicative of its potential reactivity and biological activity. The presence of a bromophenyl moiety suggests that it may exhibit unique electronic properties, while the methoxy group can influence its solubility and reactivity. The dichlorobenzoate portion contributes to the overall stability and may enhance lipophilicity, making it suitable for various applications in medicinal chemistry. This compound may also exhibit specific pharmacological properties, potentially acting as an intermediate in the synthesis of more complex molecules or as a candidate for drug development. Its structural complexity and the presence of halogen atoms could also suggest interesting interactions in biological systems, warranting further investigation into its potential uses in pharmaceuticals or agrochemicals.
Formula:C22H15BrCl2N2O4
InChI:InChI=1/C22H15BrCl2N2O4/c1-30-20-10-13(12-26-27-21(28)15-4-2-3-5-17(15)23)6-9-19(20)31-22(29)16-8-7-14(24)11-18(16)25/h2-12H,1H3,(H,27,28)
SMILES:COc1cc(ccc1OC(=O)c1ccc(cc1Cl)Cl)C=NN=C(c1ccccc1Br)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.