CAS 6628-74-6
:2-pyrrolidin-1-ylacetic acid hydrochloride
Description:
2-Pyrrolidin-1-ylacetic acid hydrochloride is a chemical compound characterized by its structure, which includes a pyrrolidine ring and an acetic acid moiety. This compound is typically encountered as a white to off-white crystalline powder and is soluble in water, which is a common trait for many hydrochloride salts. It has a molecular formula that reflects the presence of both nitrogen and carboxylic acid functional groups, contributing to its potential biological activity. The hydrochloride form enhances its stability and solubility, making it suitable for various applications in pharmaceuticals and research. This compound may exhibit properties such as being a potential neurotransmitter modulator or having implications in medicinal chemistry, particularly in the development of drugs targeting the central nervous system. As with many chemical substances, handling should be done with care, following appropriate safety protocols due to potential biological activity and the need for proper storage conditions to maintain its integrity.
Formula:C6H12ClNO2
InChI:InChI=1/C6H11NO2.ClH/c8-6(9)5-7-3-1-2-4-7;/h1-5H2,(H,8,9);1H
SMILES:C1CCN(C1)CC(=O)O.Cl
Synonyms:- 1-Pyrrolidineacetic acid, hydrochloride (1:1)
- Pyrrolidin-1-ylacetic acid hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-pyrrolidin-1-ylacetic acid
CAS:Formula:C6H12ClNO2Purity:95%Color and Shape:SolidMolecular weight:165.6180Pyrrolidin-1-yl-acetic acid hydrochloride
CAS:Formula:C6H12ClNO2Purity:95%Color and Shape:Solid, CrystallineMolecular weight:165.62(Pyrrolidin-1-yl)acetic acid hydrochloride
CAS:(Pyrrolidin-1-yl)acetic acid hydrochloridePurity:≥95%Molecular weight:165.62g/molPyrrolidin-1-yl-acetic acid hydrochloride
CAS:Pyrrolidin-1-yl-acetic acid hydrochloride is a drug that inhibits the enzyme protease, which is involved in the replication of HIV. It also inhibits the enzyme piperazine, an essential cofactor for retroviral replication. Pyrrolidin-1-yl-acetic acid hydrochloride has been shown to inhibit insulin resistance and increase glucose uptake in animal models. This drug may be a potential treatment for diabetes mellitus type 2. The structural formula of this drug is shown below:Formula:C6H12ClNO2Purity:Min. 95%Molecular weight:165.62 g/mol



