CAS 66280-26-0

Pregomisin

Description:

Pregomisin, with the CAS number 66280-26-0, is a chemical compound that belongs to the class of substances known as immunosuppressants. It is primarily characterized by its role in modulating immune responses, making it significant in the context of organ transplantation and autoimmune diseases. Pregomisin functions by inhibiting specific pathways involved in T-cell activation, thereby reducing the immune system's ability to reject transplanted tissues. The compound is typically administered in a controlled manner to minimize potential side effects, which can include increased susceptibility to infections and other complications associated with immune suppression. Its pharmacokinetics, including absorption, distribution, metabolism, and excretion, are crucial for determining appropriate dosing regimens. Additionally, Pregomisin's chemical structure features specific functional groups that contribute to its biological activity and efficacy. As with any pharmacological agent, ongoing research continues to explore its therapeutic potential and safety profile in various clinical settings.

Formula: C₂₂H₃₀O₆

InChI: InChI=1/C22H30O6/c1-13(7-15-9-17(23)21(27-5)19(11-15)25-3)14(2)8-16-10-18(24)22(28-6)20(12-16)26-4/h9-14,23-24H,7-8H2,1-6H3/t13-,14+

InChI key: InChIKey=RLRKIWSBYUZHIJ-OKILXGFUNA-N

SMILES: O(C)C1=C(OC)C=C(C[C@@H]([C@@H](CC2=CC(OC)=C(OC)C(O)=C2)C)C)C=C1O

Synonyms:

• 3,3′-Dihydroxy-4,4′,5,5′-tetramethoxylignan
• Phenol, 3,3′-[(2R,3S)-2,3-dimethyl-1,4-butanediyl]bis[5,6-dimethoxy-, rel-
• rel-3,3′-[(2R,3S)-2,3-Dimethyl-1,4-butanediyl]bis[5,6-dimethoxyphenol]
• Phenol, 3,3′-(2,3-dimethyl-1,4-butanediyl)bis[5,6-dimethoxy-, (R*,S*)-
• Pregomisin

Pregomisin

CAS: 66280-26-0

Pregomisin shows platelet-activating factor (PAF) antagonistic activity and the IC 50 value is 4.8x10(-5) M.

Formula: C₂₂H₃₀O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 390.476

Ref: TM-TN4821

Pregomisin

CAS: 66280-26-0

Formula: C₂₂H₃₀O₆

Purity: 95%~99%

Molecular weight: 390.476

Ref: BP-SBP04182

Pregomisin

CAS: 66280-26-0

Pregomisin is an investigational compound, which is derived through a synthetic chemical process, with potential applications in therapeutic settings. As a product under investigation, it operates by modulating specific cellular pathways associated with inflammation and immune response. Pregomisin primarily targets molecular mechanisms involving cytokine signaling, thereby influencing cellular behavior in disease conditions.

Formula: C₂₂H₃₀O₆

Purity: Min. 95%

Molecular weight: 390.5 g/mol

Ref: 3D-RCA28026