CAS 6629-12-5
:1,2-dithiolane-3-carboxylic acid
Description:
1,2-Dithiolane-3-carboxylic acid is a heterocyclic organic compound characterized by a five-membered ring containing two sulfur atoms and a carboxylic acid functional group. Its molecular structure features a dithiolane ring, which contributes to its unique chemical properties, including potential reactivity due to the presence of sulfur atoms that can participate in various chemical reactions, such as nucleophilic attacks. The carboxylic acid group enhances its solubility in polar solvents and allows for acid-base reactions. This compound is of interest in organic synthesis and may serve as a building block for more complex molecules. Additionally, its sulfur-containing structure may impart specific biological activities, making it a candidate for further research in medicinal chemistry. The compound is typically handled with care due to the potential for reactivity associated with sulfur-containing compounds. Overall, 1,2-dithiolane-3-carboxylic acid exhibits a combination of unique structural features and functional properties that make it relevant in various chemical applications.
Formula:C4H6O2S2
InChI:InChI=1/C4H6O2S2/c5-4(6)3-1-2-7-8-3/h3H,1-2H2,(H,5,6)
SMILES:C1CSSC1C(=O)O
Synonyms:- Acide 1,2-Dithiolane-3-Carboxylique
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Tetranorlipoic Acid
CAS:Controlled ProductApplications Tetranorlipoic acid is used as a reactant in the preparation of prazosin-related derivatives as α1-adrenoreceptor antagonists and inhibitors of intracellular oxidative stress.
References Antonello, A., et al.: J. Med. Chem., 48, 28 (2005)Formula:C4H6O2S2Color and Shape:NeatMolecular weight:150.219


