CAS 6629-96-5
:2,2,3,3,5,5,6-heptachloro-1,4-dioxane
Description:
2,2,3,3,5,5,6-heptachloro-1,4-dioxane, with the CAS number 6629-96-5, is a synthetic organic compound characterized by its chlorinated dioxane structure. This compound features a dioxane ring, which consists of two oxygen atoms and four carbon atoms, with seven chlorine atoms substituting hydrogen atoms on the carbon framework. The presence of multiple chlorine atoms significantly enhances its hydrophobicity and stability, making it resistant to degradation in various environmental conditions. It is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. Due to its chlorinated nature, it may exhibit toxicological effects and environmental persistence, raising concerns regarding its use and disposal. The compound is primarily studied for its potential applications in industrial processes, but its environmental impact necessitates careful handling and regulation. As with many chlorinated compounds, it may also be subject to scrutiny under environmental protection regulations due to its potential effects on human health and ecosystems.
Formula:C4HCl7O2
InChI:InChI=1/C4HCl7O2/c5-1-2(6,7)13-4(10,11)3(8,9)12-1/h1H
SMILES:C1(C(Cl)(Cl)OC(C(Cl)(Cl)O1)(Cl)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,2,3,3,5,5,6-Heptachloro-1,4-dioxane
CAS:2,2,3,3,5,5,6-Heptachloro-1,4-dioxaneColor and Shape:LiquidMolecular weight:329.22g/mol
