CymitQuimica logo

CAS 66298-49-5

:

4,6-Diiodo-2-methylpyrimidine

Description:
4,6-Diiodo-2-methylpyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features two iodine substituents at the 4 and 6 positions and a methyl group at the 2 position, contributing to its unique chemical properties. The presence of iodine atoms enhances its reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and material science. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the presence of halogens like iodine can influence the compound's electronic properties, stability, and lipophilicity. Safety data should be consulted, as halogenated compounds can pose health risks. Overall, 4,6-Diiodo-2-methylpyrimidine is a versatile compound with applications in research and industry.
Formula:C5H4I2N2
InChI:InChI=1/C5H4I2N2/c1-3-8-4(6)2-5(7)9-3/h2H,1H3
InChI key:PLRCTNAFIAHOAW-UHFFFAOYSA-N
SMILES:Cc1nc(cc(I)n1)I
Synonyms:
  • Pyrimidine, 4,6-Diiodo-2-Methyl-
Found 4 products.