CAS 66300-62-7

N-[(1-methylpiperidin-2-yl)methyl]ethanamine

Description:

N-[(1-methylpiperidin-2-yl)methyl]ethanamine, with the CAS number 66300-62-7, is a chemical compound that belongs to the class of amines. It features a piperidine ring substituted with a methyl group and an ethylamine moiety, which contributes to its potential biological activity. This compound is characterized by its nitrogen-containing heterocyclic structure, which can influence its solubility and reactivity. Typically, compounds of this nature may exhibit properties such as basicity due to the presence of amine groups, allowing them to participate in various chemical reactions, including nucleophilic substitutions. The presence of the piperidine ring may also impart specific steric and electronic properties, making it of interest in medicinal chemistry and drug design. Additionally, the compound's potential applications could extend to fields such as pharmacology, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. However, detailed studies on its specific physical and chemical properties, as well as its biological effects, would be necessary to fully understand its utility and safety profile.

Formula: C₉H₂₀N₂

InChI: InChI=1/C9H20N2/c1-3-10-8-9-6-4-5-7-11(9)2/h9-10H,3-8H2,1-2H3

SMILES: CCNCC1CCCCN1C