CAS 66304-01-6
:3H-1,2-benzodithiol-3-one 1,1-dioxide
Description:
3H-1,2-benzodithiol-3-one 1,1-dioxide, identified by its CAS number 66304-01-6, is a heterocyclic organic compound characterized by the presence of a benzene ring fused to a dithiol structure. This compound features a dioxo group, which contributes to its chemical reactivity and stability. Typically, it exhibits properties such as being a solid at room temperature and may have a distinct color, often associated with its aromatic nature. The presence of sulfur atoms in its structure can impart unique electronic properties, making it of interest in various chemical applications, including organic synthesis and materials science. Additionally, compounds of this type may exhibit biological activity, which can be explored for potential pharmaceutical applications. Its solubility characteristics can vary, often being soluble in organic solvents while having limited solubility in water. Overall, 3H-1,2-benzodithiol-3-one 1,1-dioxide is a compound of interest in both academic and industrial chemistry due to its unique structural features and potential applications.
Formula:C7H4O3S2
InChI:InChI=1/C7H4O3S2/c8-7-5-3-1-2-4-6(5)12(9,10)11-7/h1-4H
SMILES:c1ccc2c(c1)C(=O)SS2(=O)=O
Synonyms:- 3H-1,2-Benzodithiol-one 1,1-dioxide
- Beaucage
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
3H-1,2-Benzodithiol-3-one 1,1-Dioxide
CAS:Formula:C7H4O3S2Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:200.233H-1,2-Benzodithiol-one 1,1-dioxide, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H4O3S2Purity:98%Color and Shape:Colorless to white, Crystals or powder or crystalline powderMolecular weight:200.233H-1,2-Benzodithiol-3-one, 1,1-dioxide
CAS:Formula:C7H4O3S2Purity:98%Color and Shape:SolidMolecular weight:200.23493H-1,2-Benzodithiol-3-one-1,1-dioxide
CAS:Formula:C7H4O3S2Purity:≥ 98.0%Color and Shape:White to off-white crystalline powderMolecular weight:200.243H-1,2-Benzodithiol-3-one-1,1-dioxide
CAS:3H-1,2-Benzodithiol-3-one-1,1-dioxidePurity:98%Color and Shape:SolidMolecular weight:200.23g/mol3H-Benzo[c][1,2]dithiol-3-one 1,1-dioxide
CAS:Formula:C7H4O3S2Purity:98%Color and Shape:White powderMolecular weight:200.233H-1,2-Benzodithiol-3-one-1,1-dioxide
CAS:3H-1,2-Benzodithiol-3-one-1,1-dioxide is a diagnostic agent that binds to the epidermal growth factor receptor (EGFR) and can be used to detect EGFR protein in tissue samples. It has been shown to have an affinity for the amino acid tyrosine, which is found in proteins such as epidermal growth factors. 3H-1,2-Benzodithiol-3-one-1,1-dioxide is also an oxidative DNA agent that reacts with phosphite groups on DNA, leading to crosslinking of DNA strands and preventing replication. Monoclonal antibodies against 3H-1,2-Benzodithiol-3-one-1,1-dioxide have been generated and are used for the detection of EGFR protein in tissue samples. It was developed by solid phase synthesis and covalent linkage to alkylthio group. The molecular modeling ofFormula:C7H4O3S2Purity:Min. 95%Color and Shape:White PowderMolecular weight:200.24 g/molBeaucage reagent
CAS:Beaucage reagent, which is found to be effective in causing DNA cleavage.Formula:C7H4O3S2Purity:98.50%Color and Shape:White To Off-White PowderMolecular weight:200.23







