CAS 6631-28-3
:N'-(phenylsulfonyl)benzohydrazide
Description:
N'-(Phenylsulfonyl)benzohydrazide, with the CAS number 6631-28-3, is an organic compound characterized by its hydrazide functional group and a phenylsulfonyl moiety. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of various pharmaceuticals. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many hydrazides. The presence of the sulfonyl group enhances its reactivity, making it a useful intermediate in organic synthesis. Additionally, N'-(phenylsulfonyl)benzohydrazide may exhibit biological activity, including potential antimicrobial or anti-inflammatory effects, although specific biological properties would require further investigation. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C13H12N2O3S
InChI:InChI=1/C13H12N2O3S/c16-13(11-7-3-1-4-8-11)14-15-19(17,18)12-9-5-2-6-10-12/h1-10,15H,(H,14,16)
SMILES:c1ccc(cc1)C(=NNS(=O)(=O)c1ccccc1)O
Synonyms:- Benzoic Acid, 2-(Phenylsulfonyl)Hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
