CAS 6631-71-6

4-(piperidin-1-yl)butan-2-one

Description:

4-(Piperidin-1-yl)butan-2-one, also known by its CAS number 6631-71-6, is an organic compound characterized by its piperidine ring and a ketone functional group. This compound features a butan-2-one backbone, where a piperidine group is substituted at the fourth carbon. It is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of the piperidine moiety contributes to its basicity and potential as a nucleophile in various chemical reactions. This compound is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or other chemical entities. Its solubility in organic solvents and moderate stability under standard conditions make it a versatile compound in laboratory settings. Safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled. Overall, 4-(piperidin-1-yl)butan-2-one is a significant compound in synthetic organic chemistry with various applications.

Formula: C₉H₁₇NO

InChI: InChI=1/C9H17NO/c1-9(11)5-8-10-6-3-2-4-7-10/h2-8H2,1H3

SMILES: CC(=O)CCN1CCCCC1

Synonyms:

• 2-Butanone, 4-(1-piperidinyl)-

4-(Piperidin-1-yl)butan-2-one hydrochloride

CAS: 6631-71-6

Versatile small molecule scaffold

Formula: C₉H₁₈ClNO

Purity: Min. 95%

Molecular weight: 191.7 g/mol

Ref: 3D-GAA63171