CAS 66310-06-3

Pyridinium, 2,4,6-triphenyl-1-(2-phenylethyl)-, tetrafluoroborate(1-)

Description:

Pyridinium, 2,4,6-triphenyl-1-(2-phenylethyl)-, tetrafluoroborate(1-) is an organic compound characterized by its complex structure, which includes a pyridinium cation and a tetrafluoroborate anion. The pyridinium moiety contributes to its aromatic properties, while the presence of multiple phenyl groups enhances its stability and solubility in organic solvents. This compound typically exhibits a crystalline form and is known for its role as a reagent in various organic synthesis reactions, particularly in the field of electrochemistry and as a phase transfer catalyst. The tetrafluoroborate anion is a stable, non-coordinating counterion that helps to balance the charge of the cation. Due to its unique structure, this compound may also display interesting electronic and optical properties, making it of interest in materials science. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₃₁H₂₆NBF₄

InChI: InChI=1S/C31H26N.BF4/c1-5-13-25(14-6-1)21-22-32-30(27-17-9-3-10-18-27)23-29(26-15-7-2-8-16-26)24-31(32)28-19-11-4-12-20-28;2-1(3,4)5/h1-20,23-24H,21-22H2;/q+1;-1

InChI key: CTDSMHDKAQQVDV-UHFFFAOYSA-N

SMILES: [B-](F)(F)(F)F.C1=CC=C(C=C1)CC[N+]2=C(C=C(C=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5