CAS 66315-15-9

3-Amino-4-(methylamino)benzoic acid

Description:

3-Amino-4-(methylamino)benzoic acid, also known as a derivative of aminobenzoic acid, is an organic compound characterized by the presence of both amino and methylamino functional groups attached to a benzoic acid structure. This compound typically appears as a crystalline solid and is soluble in polar solvents such as water and alcohols due to its ability to form hydrogen bonds. The presence of the amino groups contributes to its basicity and potential reactivity in various chemical reactions, including acylation and alkylation. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs or as a biochemical probe. The compound's molecular structure allows for various interactions, including hydrogen bonding and ionic interactions, which can influence its behavior in biological systems. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₁₀N₂O₂

InChI: InChI=1S/C8H10N2O2/c1-10-7-3-2-5(8(11)12)4-6(7)9/h2-4,10H,9H2,1H3,(H,11,12)

InChI key: InChIKey=QZZIBMYRWBVKLM-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(N)=C(NC)C=C1

Synonyms:

• 3-Amino-4-methylaminobenzoic acid
• Benzoic Acid, 3-Amino-4-(Methylamino)-
• 3-Amino-4-methylamino-benzoic acid
• 3-Amino-4-(methylamino)benzoic acid

3-AMINO-4-METHYLAMINO-BENZOIC ACID

CAS: 66315-15-9

Formula: C₈H₁₀N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 166.1772

Ref: IN-DA00FC40

3-Amino-4-(methylamino)benzoic acid

CAS: 66315-15-9

3-Amino-4-(methylamino)benzoic acid

Purity: 98%

Molecular weight: 166.18g/mol

Ref: 54-OR74733

3-Amino-4-(methylamino)benzoic acid

CAS: 66315-15-9

Formula: C₈H₁₀N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 166.18

Ref: 10-F337907

3-Amino-4-(methylamino)benzoic acid

CAS: 66315-15-9

3-Amino-4-(methylamino)benzoic acid is a modified amino acid that is used in the synthesis of proteins. It has been shown to inhibit the growth of retinoblastoma cells and to bind to specific sites in cellular protein, thereby inhibiting protein synthesis. 3-Amino-4-(methylamino)benzoic acid has also been shown to be effective as a linker in chemical ligation reactions, which can be used for the synthesis of peptides and proteins. This compound has not been found to have any biochemical or chemical modifications.

Formula: C₈H₁₀N₂O₂

Purity: Min. 95%

Molecular weight: 166.18 g/mol

Ref: 3D-RCA31515