CAS 663199-28-8
:1-butyl-3-methyl-1H-imidazol-3-ium dibutyl phosphate
Description:
1-Butyl-3-methyl-1H-imidazol-3-ium dibutyl phosphate is an ionic liquid characterized by its unique structure, which combines an imidazolium cation with a dibutyl phosphate anion. This compound typically exhibits low volatility, high thermal stability, and a wide liquid range, making it suitable for various applications in green chemistry and as a solvent. Its ionic nature contributes to its ability to dissolve a wide range of polar and non-polar substances, enhancing its utility in extraction and separation processes. Additionally, the presence of the butyl groups in both the cation and anion imparts hydrophobic characteristics, which can influence solubility and miscibility with organic solvents. The compound is also known for its potential as a biodegradable alternative to traditional solvents, aligning with sustainable practices in chemical processes. Its properties can be further tailored by modifying the alkyl chain length or substituents, allowing for a diverse range of applications in catalysis, electrochemistry, and material science.
Formula:C16H33N2O4P
InChI:InChI=1/C8H15N2.C8H19O4P/c1-3-4-5-10-7-6-9(2)8-10;1-3-5-7-11-13(9,10)12-8-6-4-2/h6-8H,3-5H2,1-2H3;3-8H2,1-2H3,(H,9,10)/q+1;/p-1
Synonyms:- 1-Butyl-3-Methylimidazolium Dibutylphosphate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-n-Butyl-3-methylimidazolium di-n-butyl phosphate, 96%
CAS:1-Butyl-3-methylimidazolium dibutyl phosphate is employed as an imidazolium compound salt. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product /
Formula:C16H33N2O4PPurity:96%Molecular weight:348.421-Butyl-3-methylimidazolium dibutyl phosphate
CAS:Formula:C16H33N2O4PPurity:95%Color and Shape:LiquidMolecular weight:348.41801-n-Butyl-3-Methylimidazolium di-n-Butyl Phosphate
CAS:1-n-Butyl-3-Methylimidazolium di-n-Butyl PhosphatePurity:98%Molecular weight:348.42g/mol



