CAS 6632-68-4
:6-Amino-1,3-dimethyl-5-nitroso-2,4(1H,3H)-pyrimidinedione
Description:
6-Amino-1,3-dimethyl-5-nitroso-2,4(1H,3H)-pyrimidinedione, with the CAS number 6632-68-4, is a heterocyclic organic compound characterized by its pyrimidinedione structure, which features both amino and nitroso functional groups. This compound typically exhibits a yellow to orange color due to the presence of the nitroso group, which can influence its reactivity and stability. It is soluble in polar solvents, reflecting its potential for hydrogen bonding due to the amino group. The presence of the dimethyl groups contributes to its lipophilicity, affecting its biological activity and interaction with other molecules. This compound may be of interest in various fields, including medicinal chemistry and agricultural applications, due to its potential as a building block for more complex molecules or as a reagent in synthetic pathways. Its reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 6-Amino-1,3-dimethyl-5-nitroso-2,4(1H,3H)-pyrimidinedione is a versatile compound with notable chemical properties.
Formula:C6H8N4O3
InChI:InChI=1S/C6H8N4O3/c1-9-4(7)3(8-13)5(11)10(2)6(9)12/h7H2,1-2H3
InChI key:InChIKey=MGBDANYXBKROBW-UHFFFAOYSA-N
SMILES:N(=O)C1=C(N)N(C)C(=O)N(C)C1=O
Synonyms:- 1,3-Dimethyl-4-amino-5-nitrosouracil
- 2,4(1H,3H)-Pyrimidinedione, 6-amino-1,3-dimethyl-5-nitroso-
- 4-Amino-1,3-dimethyl-5-nitrosouracil
- 6-Amino-1,3-dimethyl-5-nitroso-2,4(1H,3H)-pyrimidinedione
- 6-Amino-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione
- 6-Amino-1,3-dimethyl-5-nitrosouracil
- 8-[(dimethylamino)methyl]-7-hydroxy-3-(naphthalen-2-yloxy)-2-(trifluoromethyl)-4H-chromen-4-one
- NSC 11775
- NSC 41585
- NSC 41832
- NSC 42306
- NSC 677508
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
6-Amino-1,3-dimethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione
CAS:6-Amino-1,3-dimethyl-5-nitrosopyrimidine-2,4(1H,3H)-dioneFormula:C6H8N4O3Purity:98% (water<30%)Molecular weight:184.156-AMINO-1,3-DIMETHYL-5-NITROSOURACIL
CAS:Formula:C6H8N4O3Purity:98%Color and Shape:SolidMolecular weight:184.15276-amino-1,3-dimethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione
CAS:Formula:C6H8N4O3Purity:≥97%(water≤ 35%)Molecular weight:184.1554-Amino-1,3-dimethyl-5-nitrosouracil x-H2O
CAS:Controlled ProductApplications 4-Amino-1,3-dimethyl-5-nitrosouracil is a useful building block for organic synthesis.
Formula:C6H8N4O3Color and Shape:NeatMolecular weight:184.154-Amino-1,3-dimethyl-2,6-dioxo-5-nitrosopyrimidine
CAS:4-Amino-1,3-dimethyl-2,6-dioxo-5-nitrosopyrimidine is a monoclonal antibody that binds to cancer cells. It has been shown to be effective in the treatment of leukemia, Hodgkin's disease, and non-Hodgkin's lymphoma. The binding of 4-Amino-1,3-dimethyl-2,6-dioxo-5-nitrosopyrimidine to cancer cells is due to the formation of a coordination geometry between the copper complex and the nitrogen atoms on the amino group. This drug has been shown to inhibit tumor growth by blocking the synthesis of DNA and RNA, which are key components in cell division. 4AADNP also inhibits cancer cells' ability to uptake glucose by inhibiting cellular glucose transporters. The binding affinity of 4AADNP for cancer cells is higher than for normal cells because cancer cells have more receptors for this drugFormula:C6H8N4O3Purity:Min. 95%Molecular weight:184.15 g/molRef: ST-EA-CP-NIT140
Discontinued product






