CymitQuimica logo

CAS 66323-46-4

:

3'-azido-2',3'-dideoxyguanosine

Description:
3'-Azido-2',3'-dideoxyguanosine (often abbreviated as AZD) is a nucleoside analog that is primarily recognized for its role in antiviral therapy, particularly in the treatment of HIV. This compound features an azido group at the 3' position and lacks the hydroxyl group at the 2' and 3' positions of the ribose sugar, which is characteristic of dideoxynucleosides. The absence of these hydroxyl groups prevents the formation of phosphodiester bonds during DNA synthesis, effectively terminating the elongation of the viral DNA chain when incorporated. AZD exhibits selective inhibition of reverse transcriptase, an enzyme crucial for the replication of retroviruses. Its structural modifications enhance its stability and bioavailability compared to natural nucleosides. Additionally, 3'-azido-2',3'-dideoxyguanosine has been studied for its potential in research applications beyond antiviral therapy, including its effects on cellular mechanisms and its role in the development of other therapeutic agents. As with many nucleoside analogs, careful consideration of its pharmacokinetics and potential side effects is essential in clinical settings.
Formula:C10H12N8O3
InChI:InChI=1/C10H12N8O3/c11-10-14-8-7(9(20)15-10)13-3-18(8)6-1-4(16-17-12)5(2-19)21-6/h3-6,19H,1-2H2,(H3,11,14,15,20)/t4-,5+,6+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.