CAS 66323-49-7
:3'-Amino-2',3'-dideoxyguanosine
Description:
3'-Amino-2',3'-dideoxyguanosine is a modified nucleoside that plays a significant role in biochemical research and pharmaceutical applications. As a derivative of guanosine, it features an amino group at the 3' position and lacks the hydroxyl group at the 2' and 3' positions, which classifies it as a dideoxynucleoside. This structural modification imparts unique properties, making it a valuable tool in studies of nucleic acid synthesis and function. The absence of the 2' hydroxyl group renders it resistant to further phosphorylation, which is crucial in the context of antiviral and anticancer drug development, as it can inhibit viral replication and cellular proliferation. Additionally, 3'-Amino-2',3'-dideoxyguanosine can be incorporated into DNA strands, allowing researchers to investigate its effects on nucleic acid interactions and stability. Its CAS number, 66323-49-7, facilitates its identification in chemical databases, aiding in the exploration of its potential therapeutic applications and mechanisms of action in molecular biology.
Formula:C10H14N6O3
InChI:InChI=1/C10H14N6O3/c11-4-1-6(19-5(4)2-17)16-3-13-7-8(16)14-10(12)15-9(7)18/h3-6,17H,1-2,11H2,(H3,12,14,15,18)/t4-,5+,6+/m0/s1
Synonyms:- 2-Amino-9-[(2R,4S,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one
- 3'-NH2-ddG
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3'-Amino-2',3'-dideoxyguanosine
CAS:3'-Amino-2',3'-dideoxyguanosineFormula:C10H14N6O3Purity:By hplc: 99% (Typical Value in Batch COA)Color and Shape: off-white crystalsMolecular weight:266.26g/mol3'-Amino-2',3'-dideoxyguanosine
CAS:3'-Amino-2',3'-dideoxyguanosine's lack of a 3'-hydroxyl group makes it a chain terminator for DNA polymerase, a key application in Sanger sequencing. Additionally, the 3'-amino group serves as a functional handle for modifying the 3' end of oligonucleotides with various labels or conjugates, expanding their utility in research and diagnostics.Formula:C10H14N6O3Purity:(%) Min. 95%Color and Shape:Off-White PowderMolecular weight:266.26 g/mol




