CAS 66328-69-6
:1,2,5-Oxadiazol-3-amine, 4-nitro-
Description:
1,2,5-Oxadiazol-3-amine, 4-nitro- is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and one oxygen atom within a five-membered ring structure. The compound features an amino group (-NH2) at the 3-position and a nitro group (-NO2) at the 4-position of the oxadiazole ring, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. It is typically a crystalline solid at room temperature and may exhibit solubility in polar solvents. The presence of both the amino and nitro functional groups suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the compound's unique structure may impart specific biological activities, making it of interest for further research in medicinal chemistry. Safety data should be consulted for handling and storage, as compounds with nitro groups can sometimes be sensitive or hazardous.
Formula:C2H2N4O3
InChI:InChI=1/C2H2N4O3/c3-1-2(6(7)8)5-9-4-1/h(H2,3,4)
SMILES:c1(c(non1)N(=O)=O)N
Synonyms:- 4-Nitro-1,2,5-oxadiazol-3-amine
- 3-Amino-4-nitrofurazan
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Nitro-1,2,5-oxadiazol-3-amine
CAS:Controlled Product4-Nitro-1,2,5-oxadiazol-3-amine is a molecule that has been shown to be an inhibitor of the epidermal growth factor receptor (EGFR). The optimal reaction conditions for this molecule were determined by crystallography. These results were confirmed by prognosis assays and the determination of tautomers. This molecule may be used in diagnosis and as a potential treatment for cancer. 4-Nitro-1,2,5-oxadiazol-3-amine binds to the EGFR at a site different from that of erlotinib, an inhibitor currently used in the clinic. This binding leads to inhibition of protein synthesis and cell division by preventing the activation of downstream signal transduction pathways. The molecule also inhibits tumor cell proliferation and induces apoptosis by preventing the production of nitric oxide (NO) and reactive oxygen species (ROS).Formula:C2H2N4O3Purity:Min. 95%Molecular weight:130.06 g/mol


